CAS 1444821-91-3 appears in our catalog under these names: 1,6-Di(pyridin-4-yl)pyrene, 95%, 95%, 1,6-Di(pyridin-4-yl)pyrene, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(6-pyridin-4-ylpyren-1-yl)pyridine (CAS 1444821-91-3) is a chemical compound with the molecular formula C26H16N2 and a molecular weight of 356.4 g/mol. IUPAC name: 4-(6-pyridin-4-ylpyren-1-yl)pyridine. InChIKey: LTMUKJMMVBKYHO-UHFFFAOYSA-N.
| Molecular formula | C26H16N2 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 4-(6-pyridin-4-ylpyren-1-yl)pyridine |
| InChIKey | LTMUKJMMVBKYHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC3=C4C2=C1C=CC4=C(C=C3)C5=CC=NC=C5)C6=CC=NC=C6 |
Computed by PubChem (NCBI)