CAS 1445-78-9 appears in our catalog under these names: 2,5-Diphenylthiophene, 95%, 2,5–Diphenylthiophene, 2,5-Diphenylthiophene, 2,5-Diphenylthiophene, >98.0%(GC), 2,5-Diphenylthiophene 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 250mg, 10g, 25g, 1g, 2g, 100mg.
2,5-diphenylthiophene (CAS 1445-78-9) is a chemical compound with the molecular formula C16H12S and a molecular weight of 236.3 g/mol. IUPAC name: 2,5-diphenylthiophene. InChIKey: HWKZNRABKQDKTC-UHFFFAOYSA-N.
| Molecular formula | C16H12S |
|---|---|
| Molecular weight | 236.3 g/mol |
| IUPAC name | 2,5-diphenylthiophene |
| InChIKey | HWKZNRABKQDKTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(S2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)