CAS 144501-27-9 is the registry number for GR 92549. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E,3S,5R)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 144501-27-9) is a chemical compound with the molecular formula C25H26F2N2O4 and a molecular weight of 456.5 g/mol. IUPAC name: (E,3S,5R)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: GQOQQDINYJTQDY-GOHIESPPSA-N.
| Molecular formula | C25H26F2N2O4 |
|---|---|
| Molecular weight | 456.5 g/mol |
| IUPAC name | (E,3S,5R)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | GQOQQDINYJTQDY-GOHIESPPSA-N |
| SMILES | CC(C)C1=NC(=C(N1/C=C/[C@@H](C[C@@H](CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)