Products 1445322-51-9

CAS 1445322-51-9 is the registry number for 4-(2-Bromophenoxy)-3-fluoroaniline hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-(2-bromophenoxy)-3-fluoroaniline;hydrochloride (CAS 1445322-51-9) is a chemical compound with the molecular formula C12H10BrClFNO and a molecular weight of 318.57 g/mol. IUPAC name: 4-(2-bromophenoxy)-3-fluoroaniline;hydrochloride. InChIKey: JRULAJCWHYLELC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrClFNO
Molecular weight318.57 g/mol
IUPAC name4-(2-bromophenoxy)-3-fluoroaniline;hydrochloride
InChIKeyJRULAJCWHYLELC-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OC2=C(C=C(C=C2)N)F)Br.Cl

Computed by PubChem (NCBI)