Products 1445322-52-0

CAS 1445322-52-0 is the registry number for 1,4-Dimethanesulfonyl-2-(trifluoromethyl)benzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1,4-bis(methylsulfonyl)-2-(trifluoromethyl)benzene (CAS 1445322-52-0) is a chemical compound with the molecular formula C9H9F3O4S2 and a molecular weight of 302.3 g/mol. IUPAC name: 1,4-bis(methylsulfonyl)-2-(trifluoromethyl)benzene. InChIKey: ADZOVEDEOVHJOS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9F3O4S2
Molecular weight302.3 g/mol
IUPAC name1,4-bis(methylsulfonyl)-2-(trifluoromethyl)benzene
InChIKeyADZOVEDEOVHJOS-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=C(C=C1)S(=O)(=O)C)C(F)(F)F

Computed by PubChem (NCBI)