CAS 1445322-57-5 is the registry number for N-(4-Formylphenyl)-N-methanesulfonylmethanesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-(4-formylphenyl)-N-methylsulfonylmethanesulfonamide (CAS 1445322-57-5) is a chemical compound with the molecular formula C9H11NO5S2 and a molecular weight of 277.3 g/mol. IUPAC name: N-(4-formylphenyl)-N-methylsulfonylmethanesulfonamide. InChIKey: BRCCIENXTHBMHV-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | N-(4-formylphenyl)-N-methylsulfonylmethanesulfonamide |
| InChIKey | BRCCIENXTHBMHV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(C1=CC=C(C=C1)C=O)S(=O)(=O)C |
Computed by PubChem (NCBI)