Products 1445322-58-6

CAS 1445322-58-6 is the registry number for 3-(Cbz-Amino)-1,5-dimethylpyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-(1,5-dimethylpyrazol-3-yl)carbamate (CAS 1445322-58-6) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: benzyl N-(1,5-dimethylpyrazol-3-yl)carbamate. InChIKey: SBLMQFZKHYPZIC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15N3O2
Molecular weight245.28 g/mol
IUPAC namebenzyl N-(1,5-dimethylpyrazol-3-yl)carbamate
InChIKeySBLMQFZKHYPZIC-UHFFFAOYSA-N
SMILESCC1=CC(=NN1C)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)