CAS 144550-79-8 appears in our catalog under these names: 2-(Aminosulfonyl)-4-iodobenzoic acid methyl ester, 98%, 2–(Aminosulfonyl)–4–iodobenzoic acid methyl ester, Methyl 4-iodo-2-sulfamoylbenzoate 98%, 2-(Aminosulfonyl)-4-iodobenzoic acid methyl ester, 98%, 98%, 2-(Aminosulfonyl)-4-iodobenzoic acid methyl ester. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, HPC Standards. Available pack sizes: 1g, 5g, 10g, 25g, 1x100mg, 100g.
Methyl 4-iodo-2-sulfamoylbenzoate (CAS 144550-79-8) is a chemical compound with the molecular formula C8H8INO4S and a molecular weight of 341.13 g/mol. IUPAC name: methyl 4-iodo-2-sulfamoylbenzoate. InChIKey: DZERRHAHFNNWSI-UHFFFAOYSA-N.
| Molecular formula | C8H8INO4S |
|---|---|
| Molecular weight | 341.13 g/mol |
| IUPAC name | methyl 4-iodo-2-sulfamoylbenzoate |
| InChIKey | DZERRHAHFNNWSI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)I)S(=O)(=O)N |
Computed by PubChem (NCBI)