Products 1445586-42-4

CAS 1445586-42-4 is the registry number for Pralatrexate Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

4-[1-(2-amino-4-oxo-3H-pteridin-6-yl)pent-4-yn-2-yl]benzoic acid (CAS 1445586-42-4) is a chemical compound with the molecular formula C18H15N5O3 and a molecular weight of 349.3 g/mol. IUPAC name: 4-[1-(2-amino-4-oxo-3H-pteridin-6-yl)pent-4-yn-2-yl]benzoic acid. InChIKey: OVAQXJSDCVIIDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15N5O3
Molecular weight349.3 g/mol
IUPAC name4-[1-(2-amino-4-oxo-3H-pteridin-6-yl)pent-4-yn-2-yl]benzoic acid
InChIKeyOVAQXJSDCVIIDZ-UHFFFAOYSA-N
SMILESC#CCC(CC1=CN=C2C(=N1)C(=O)NC(=N2)N)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)