CAS 1445751-74-5 appears in our catalog under these names: AB–005 azepane isomer, AB-005 Azepane Isomer, Ab-005 azepane isomer-d3. Offered by: GLPBio, TRC, Biosynth. Available pack sizes: 5mg, 250mg, 1mg, 10mg, 25mg, 50mg.
[1-(1-methylazepan-3-yl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (CAS 1445751-74-5) is a chemical compound with the molecular formula C23H32N2O and a molecular weight of 352.5 g/mol. IUPAC name: [1-(1-methylazepan-3-yl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone. InChIKey: VNSNHIFBQMRMRE-UHFFFAOYSA-N.
| Molecular formula | C23H32N2O |
|---|---|
| Molecular weight | 352.5 g/mol |
| IUPAC name | [1-(1-methylazepan-3-yl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| InChIKey | VNSNHIFBQMRMRE-UHFFFAOYSA-N |
| SMILES | CC1(C(C1(C)C)C(=O)C2=CN(C3=CC=CC=C32)C4CCCCN(C4)C)C |
Computed by PubChem (NCBI)