CAS 1445752-09-9 appears in our catalog under these names: AB-PINACA (1.0 mg/mL in Methanol), AB-PINACA, AB-PINACA, 0.1mg/ml in Methanol, AB–PINACA (CRM). Offered by: TRC, Lipomed, GLPBio. Available pack sizes: 5x1ml, 100mg, 50mg, 10mg, 1ml, 1mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-pentylindazole-3-carboxamide (CAS 1445752-09-9) is a chemical compound with the molecular formula C18H26N4O2 and a molecular weight of 330.4 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-pentylindazole-3-carboxamide. InChIKey: GIMHPAQOAAZSHS-HNNXBMFYSA-N.
| Molecular formula | C18H26N4O2 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-pentylindazole-3-carboxamide |
| InChIKey | GIMHPAQOAAZSHS-HNNXBMFYSA-N |
| SMILES | CCCCCN1C2=CC=CC=C2C(=N1)C(=O)N[C@@H](C(C)C)C(=O)N |
Computed by PubChem (NCBI)