CAS 1445772-45-1 appears in our catalog under these names: Xanthone Impurity 1 (Xanthone Triflate), Xanthone Triflate, 9-Oxo-9H-xanthen-2-yl Trifluoromethanesulfonate. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5g.
(9-oxoxanthen-2-yl) trifluoromethanesulfonate (CAS 1445772-45-1) is a chemical compound with the molecular formula C14H7F3O5S and a molecular weight of 344.26 g/mol. IUPAC name: (9-oxoxanthen-2-yl) trifluoromethanesulfonate. InChIKey: GSUHEVOMVRDXDA-UHFFFAOYSA-N.
| Molecular formula | C14H7F3O5S |
|---|---|
| Molecular weight | 344.26 g/mol |
| IUPAC name | (9-oxoxanthen-2-yl) trifluoromethanesulfonate |
| InChIKey | GSUHEVOMVRDXDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)