Products 1445950-80-0

CAS 1445950-80-0 appears in our catalog under these names: 1,5-Dimethyl-1h-pyrrole-3-carboxylic acid, 95%, 1,5-Dimethyl-1H-pyrrole-3-carboxylic acid, 98+%, 1,5-Dimethyl-1H-Pyrrole-3-Carboxylic Acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,5-dimethylpyrrole-3-carboxylic acid (CAS 1445950-80-0) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: 1,5-dimethylpyrrole-3-carboxylic acid. InChIKey: YFHWYDVJHRDYAP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO2
Molecular weight139.15 g/mol
IUPAC name1,5-dimethylpyrrole-3-carboxylic acid
InChIKeyYFHWYDVJHRDYAP-UHFFFAOYSA-N
SMILESCC1=CC(=CN1C)C(=O)O

Computed by PubChem (NCBI)