CAS 1445951-09-6 appears in our catalog under these names: tert-Butyl 5-bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-1-carboxylate, 97%, 97%, tert-Butyl 5-bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-1-carboxylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Tert-butyl 5-bromospiro[2H-indole-3,4'-oxane]-1-carboxylate (CAS 1445951-09-6) is a chemical compound with the molecular formula C17H22BrNO3 and a molecular weight of 368.3 g/mol. IUPAC name: tert-butyl 5-bromospiro[2H-indole-3,4'-oxane]-1-carboxylate. InChIKey: LKYRVUIMASOGGH-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO3 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | tert-butyl 5-bromospiro[2H-indole-3,4'-oxane]-1-carboxylate |
| InChIKey | LKYRVUIMASOGGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCOCC2)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)