CAS 144599-95-1 appears in our catalog under these names: N–Boc–1–Boc–L–tryptophan, N-Boc-1-Boc-L-tryptophan, 95% , Boc-Trp(Boc)-OH, 98%, Boc-L-Trp(Boc)-OH, Boc-Trp(Boc)-OH. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Combi-blocks, Iris Biotech, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 50g, 250g, 500g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid (CAS 144599-95-1) is a chemical compound with the molecular formula C21H28N2O6 and a molecular weight of 404.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid. InChIKey: FATGZMFSCKUQGO-HNNXBMFYSA-N.
| Molecular formula | C21H28N2O6 |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid |
| InChIKey | FATGZMFSCKUQGO-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CN(C2=CC=CC=C21)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)