Products 1445994-28-4
CAS 1445994-28-4 is the registry number for PROTAC BRD4 ligand-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-amino-2-(2,4-difluorophenoxy)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (CAS 1445994-28-4) is a chemical compound with the molecular formula C20H15F2N3O2 and a molecular weight of 367.3 g/mol. IUPAC name: 4-[5-amino-2-(2,4-difluorophenoxy)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: NVUSQWQYTPQVBH-UHFFFAOYSA-N.
| Molecular formula | C20H15F2N3O2 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | 4-[5-amino-2-(2,4-difluorophenoxy)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | NVUSQWQYTPQVBH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)NC=C2)C3=C(C=CC(=C3)N)OC4=C(C=C(C=C4)F)F |
Computed by PubChem (NCBI)