Products 144606-93-9
CAS 144606-93-9 is the registry number for (+)-Carbovir triphosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 144606-93-9) is a chemical compound with the molecular formula C11H16N5O11P3 and a molecular weight of 487.19 g/mol. IUPAC name: [[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: CQCAEOCIDCCJDQ-NKWVEPMBSA-N.
| Molecular formula | C11H16N5O11P3 |
|---|---|
| Molecular weight | 487.19 g/mol |
| IUPAC name | [[(1R,4S)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | CQCAEOCIDCCJDQ-NKWVEPMBSA-N |
| SMILES | C1[C@H](C=C[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)