CAS 1446089-84-4 appears in our catalog under these names: Dichlorodenafil, Dichlorodenafil, >95% (HPLC), Dichlorodenafil-d5. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: on request, 100mg, 10mg, 5mg, 50mg.
5-[5-[(Z)-1,2-dichloroethenyl]-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CAS 1446089-84-4) is a chemical compound with the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.3 g/mol. IUPAC name: 5-[5-[(Z)-1,2-dichloroethenyl]-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one. InChIKey: VMGSRGGXUFBMAP-RAXLEYEMSA-N.
| Molecular formula | C19H20Cl2N4O2 |
|---|---|
| Molecular weight | 407.3 g/mol |
| IUPAC name | 5-[5-[(Z)-1,2-dichloroethenyl]-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| InChIKey | VMGSRGGXUFBMAP-RAXLEYEMSA-N |
| SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)/C(=C/Cl)/Cl)OCC)C |
Computed by PubChem (NCBI)