CAS 1446113-65-0 is the registry number for N6-Benzoyl-9-(2'-deoxy-2'-fluoro-b-D-arabinofuranosyl)adenine. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
N-[9-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (CAS 1446113-65-0) is a chemical compound with the molecular formula C17H16FN5O4 and a molecular weight of 373.3 g/mol. IUPAC name: N-[9-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide. InChIKey: HLJZTLWDAQVZBU-UHFFFAOYSA-N.
| Molecular formula | C17H16FN5O4 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | N-[9-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| InChIKey | HLJZTLWDAQVZBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)O)F |
Computed by PubChem (NCBI)