CAS 144619-38-5 is the registry number for tert-Butyl (4s)-4-[(e)-3-bromoprop-1-enyl]-2,2-dimethyl-oxazolidine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
Tert-butyl (4S)-4-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 144619-38-5) is a chemical compound with the molecular formula C13H22BrNO3 and a molecular weight of 320.22 g/mol. IUPAC name: tert-butyl (4S)-4-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: LRQFEHKKEOQOPY-FGEFZZPRSA-N.
| Molecular formula | C13H22BrNO3 |
|---|---|
| Molecular weight | 320.22 g/mol |
| IUPAC name | tert-butyl (4S)-4-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | LRQFEHKKEOQOPY-FGEFZZPRSA-N |
| SMILES | CC1(N([C@H](CO1)/C=C/CBr)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)