CAS 1446333-79-4 appears in our catalog under these names: 3-(2-Bromoacetyl)-7-fluorochromen-2-one, 95%, 3-(2-Bromoacetyl)-7-fluorochromen-2-one, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g.
3-(2-bromoacetyl)-7-fluorochromen-2-one (CAS 1446333-79-4) is a chemical compound with the molecular formula C11H6BrFO3 and a molecular weight of 285.07 g/mol. IUPAC name: 3-(2-bromoacetyl)-7-fluorochromen-2-one. InChIKey: QTKTXAWIRPEKHC-UHFFFAOYSA-N.
| Molecular formula | C11H6BrFO3 |
|---|---|
| Molecular weight | 285.07 g/mol |
| IUPAC name | 3-(2-bromoacetyl)-7-fluorochromen-2-one |
| InChIKey | QTKTXAWIRPEKHC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)OC(=O)C(=C2)C(=O)CBr |
Computed by PubChem (NCBI)