CAS 1446438-79-4 is the registry number for rel-(1R,2R)-1-Amino-6-bromo-2,3-dihydro-1H-inden-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R)-1-amino-6-bromo-2,3-dihydro-1H-inden-2-ol (CAS 1446438-79-4) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: (1R,2R)-1-amino-6-bromo-2,3-dihydro-1H-inden-2-ol. InChIKey: BCTITPKCHCGPPC-RKDXNWHRSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | (1R,2R)-1-amino-6-bromo-2,3-dihydro-1H-inden-2-ol |
| InChIKey | BCTITPKCHCGPPC-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H](C2=C1C=CC(=C2)Br)N)O |
Computed by PubChem (NCBI)