CAS 1446507-39-6 appears in our catalog under these names: 2,4-Dichloro-6-(6-chloropyridin-2-yl)-1,3,5-triazine, 95%, 2,4-Dichloro-6-(6-chloropyridin-2-yl)-1,3,5-triazine, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
2,4-dichloro-6-(6-chloro-2-pyridinyl)-1,3,5-triazine (CAS 1446507-39-6) is a chemical compound with the molecular formula C8H3Cl3N4 and a molecular weight of 261.5 g/mol. IUPAC name: 2,4-dichloro-6-(6-chloro-2-pyridinyl)-1,3,5-triazine. InChIKey: RTYDGUOMELKMEU-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N4 |
|---|---|
| Molecular weight | 261.5 g/mol |
| IUPAC name | 2,4-dichloro-6-(6-chloro-2-pyridinyl)-1,3,5-triazine |
| InChIKey | RTYDGUOMELKMEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)