CAS 144651-06-9 appears in our catalog under these names: Oxasulfuron, 95%, Oxasulfuron, Oxasulfuron, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Combi-blocks, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg, 1000mg, 2000mg.
Oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate (CAS 144651-06-9) is a chemical compound with the molecular formula C17H18N4O6S and a molecular weight of 406.4 g/mol. IUPAC name: oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate. InChIKey: IOXAXYHXMLCCJJ-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O6S |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate |
| InChIKey | IOXAXYHXMLCCJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC3COC3)C |
Computed by PubChem (NCBI)