Products 1446747-29-0
CAS 1446747-29-0 is the registry number for 2-(Benzo(d)oxazol-2-yl)-4-iodo-5-methoxyphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
2-(1,3-benzoxazol-2-yl)-4-iodo-5-methoxyphenol (CAS 1446747-29-0) is a chemical compound with the molecular formula C14H10INO3 and a molecular weight of 367.14 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-yl)-4-iodo-5-methoxyphenol. InChIKey: ZIZBTNYEJCAJIE-UHFFFAOYSA-N.
| Molecular formula | C14H10INO3 |
|---|---|
| Molecular weight | 367.14 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-yl)-4-iodo-5-methoxyphenol |
| InChIKey | ZIZBTNYEJCAJIE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)O)C2=NC3=CC=CC=C3O2)I |
Computed by PubChem (NCBI)