Products 14468-87-2

CAS 14468-87-2 is the registry number for 3-Azidopropanoyl chloride. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

3-azidopropanoyl chloride (CAS 14468-87-2) is a chemical compound with the molecular formula C3H4ClN3O and a molecular weight of 133.54 g/mol. IUPAC name: 3-azidopropanoyl chloride. InChIKey: KLVVMXFIJMTSKB-UHFFFAOYSA-N.

Identity
Molecular formulaC3H4ClN3O
Molecular weight133.54 g/mol
IUPAC name3-azidopropanoyl chloride
InChIKeyKLVVMXFIJMTSKB-UHFFFAOYSA-N
SMILESC(CN=[N+]=[N-])C(=O)Cl

Computed by PubChem (NCBI)