Products 144689-23-6
CAS 144689-23-6 appears in our catalog under these names: Olmesartan Medoxomil Impurity E, Olmesartan Ethyl Ester Impurity, Olmesartan Acid Ethyl Ester, >95% (HPLC), Olmesartan Ethyl Ester, Olmesartan ethyl ester. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Chemat. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 1mg, 5mg, 50 mg.
Ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate (CAS 144689-23-6) is a chemical compound with the molecular formula C26H30N6O3 and a molecular weight of 474.6 g/mol. IUPAC name: ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate. InChIKey: RYYGFMDEVYVZGY-UHFFFAOYSA-N.
| Molecular formula | C26H30N6O3 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | ethyl 5-(2-hydroxypropan-2-yl)-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| InChIKey | RYYGFMDEVYVZGY-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)C(=O)OCC)C(C)(C)O |
Computed by PubChem (NCBI)