CAS 144690-04-0 appears in our catalog under these names: Olmesartan Impurity 59, Olmesartan Impurity 17, 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid 97%, 4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazole-5-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylic acid (CAS 144690-04-0) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylic acid. InChIKey: FREDNUVVPQMYKQ-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazole-4-carboxylic acid |
| InChIKey | FREDNUVVPQMYKQ-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1)C(C)(C)O)C(=O)O |
Computed by PubChem (NCBI)