CAS 1447-71-8 appears in our catalog under these names: Dosulepin EP Impurity A, Dosulepin Impurity 1 (Dosulepin EP Impurity A), Dosulepin S-oxide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3E)-N,N-dimethyl-3-(5-oxo-6H-benzo[c][1]benzothiepin-11-ylidene)propan-1-amine (CAS 1447-71-8) is a chemical compound with the molecular formula C19H21NOS and a molecular weight of 311.4 g/mol. IUPAC name: (3E)-N,N-dimethyl-3-(5-oxo-6H-benzo[c][1]benzothiepin-11-ylidene)propan-1-amine. InChIKey: NBNPVRZHUPMVQS-GZTJUZNOSA-N.
| Molecular formula | C19H21NOS |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (3E)-N,N-dimethyl-3-(5-oxo-6H-benzo[c][1]benzothiepin-11-ylidene)propan-1-amine |
| InChIKey | NBNPVRZHUPMVQS-GZTJUZNOSA-N |
| SMILES | CN(C)CC/C=C/1\C2=CC=CC=C2CS(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)