Products 144700-55-0
CAS 144700-55-0 appears in our catalog under these names: Rhodamine B NHS ester, 99.87%, Rhodamine B NHS ester, 95% (HPLC, contains DCM). Offered by: MedChemExpress, Ambeed. Available pack sizes: 25 mg, 10 mg, 50 mg, 5 mg, 5mg, 10mg, 25mg, 50mg.
[6-(diethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]xanthen-3-ylidene]-diethylazanium chloride (CAS 144700-55-0) is a chemical compound with the molecular formula C32H34ClN3O5 and a molecular weight of 576.1 g/mol. IUPAC name: [6-(diethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]xanthen-3-ylidene]-diethylazanium chloride. InChIKey: LIFBUFAPZUVEEW-UHFFFAOYSA-M.
| Molecular formula | C32H34ClN3O5 |
|---|---|
| Molecular weight | 576.1 g/mol |
| IUPAC name | [6-(diethylamino)-9-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]xanthen-3-ylidene]-diethylazanium chloride |
| InChIKey | LIFBUFAPZUVEEW-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)ON5C(=O)CCC5=O.[Cl-] |
Computed by PubChem (NCBI)