CAS 144701-81-5 appears in our catalog under these names: Desmethyl Telmisartan, Telmisartan N-Desmethyl Impurity, Telmisartan Impurity 36, N-Desmethyl Telmisartan, 4'-((4'Methyl-2'-propyl(2,6'-bi-1H-benzimidazol)-1'-yl)methyl)(1,1'-biphenyl)-2-carboxylic acid. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 2mg.
2-[4-[[6-(1H-benzimidazol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid (CAS 144701-81-5) is a chemical compound with the molecular formula C32H28N4O2 and a molecular weight of 500.6 g/mol. IUPAC name: 2-[4-[[6-(1H-benzimidazol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid. InChIKey: VRBXIPRPTFMJQC-UHFFFAOYSA-N.
| Molecular formula | C32H28N4O2 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | 2-[4-[[6-(1H-benzimidazol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
| InChIKey | VRBXIPRPTFMJQC-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C(=O)O)C=C(C=C2C)C5=NC6=CC=CC=C6N5 |
Computed by PubChem (NCBI)