CAS 1447606-92-9 appears in our catalog under these names: 1-(Methyl-d3)-4-nitro-1H-pyrazole, 98%, 1-(Methyl-d3)-4-nitro-1H-pyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 50mg, 0,5g.
4-nitro-1-(trideuteriomethyl)pyrazole (CAS 1447606-92-9) is a chemical compound with the molecular formula C4H5N3O2 and a molecular weight of 130.12 g/mol. IUPAC name: 4-nitro-1-(trideuteriomethyl)pyrazole. InChIKey: CZVJIVYLYOVBRP-FIBGUPNXSA-N.
| Molecular formula | C4H5N3O2 |
|---|---|
| Molecular weight | 130.12 g/mol |
| IUPAC name | 4-nitro-1-(trideuteriomethyl)pyrazole |
| InChIKey | CZVJIVYLYOVBRP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)