CAS 1447608-08-3 appears in our catalog under these names: 5-Fluorospiro(indene-2,4'-piperidin)-1(3H)-one hydrochloride, 97%, 5-Fluorospiro(indene-2,4'-piperidin)-1(3H)-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-fluorospiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride (CAS 1447608-08-3) is a chemical compound with the molecular formula C13H15ClFNO and a molecular weight of 255.71 g/mol. IUPAC name: 5-fluorospiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride. InChIKey: PGSORMHQTMAJOI-UHFFFAOYSA-N.
| Molecular formula | C13H15ClFNO |
|---|---|
| Molecular weight | 255.71 g/mol |
| IUPAC name | 5-fluorospiro[3H-indene-2,4'-piperidine]-1-one;hydrochloride |
| InChIKey | PGSORMHQTMAJOI-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC3=C(C2=O)C=CC(=C3)F.Cl |
Computed by PubChem (NCBI)