Products 1447761-33-2

CAS 1447761-33-2 is the registry number for 4,4′-[(1Z,3Z)-1,4-Diphenyl-1,3-butadiene-1,4-diyl]bis[benzoic acid], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(1Z,3Z)-4-(4-carboxyphenyl)-1,4-diphenylbuta-1,3-dienyl]benzoic acid (CAS 1447761-33-2) is a chemical compound with the molecular formula C30H22O4 and a molecular weight of 446.5 g/mol. IUPAC name: 4-[(1Z,3Z)-4-(4-carboxyphenyl)-1,4-diphenylbuta-1,3-dienyl]benzoic acid. InChIKey: IPIFPGMOTKZWTQ-RSSRHXQMSA-N.

Identity
Molecular formulaC30H22O4
Molecular weight446.5 g/mol
IUPAC name4-[(1Z,3Z)-4-(4-carboxyphenyl)-1,4-diphenylbuta-1,3-dienyl]benzoic acid
InChIKeyIPIFPGMOTKZWTQ-RSSRHXQMSA-N
SMILESC1=CC=C(C=C1)/C(=C/C=C(\C2=CC=C(C=C2)C(=O)O)/C3=CC=CC=C3)/C4=CC=C(C=C4)C(=O)O

Computed by PubChem (NCBI)