Products 1447815-38-4
CAS 1447815-38-4 appears in our catalog under these names: FeRhoNox–1(Fe2+ indicaton), RhoNox-1, 98.54%, RhoNox-1 (solution), RhoNox-1, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 250ug, 5*50ug, 50ug, 10mM/1mL, 50 mg, 10 mg, 5 mg, 25 mg.
2-[3-diethylazaniumylidene-6-[diethyl(oxido)azaniumyl]xanthen-9-yl]benzoate (CAS 1447815-38-4) is a chemical compound with the molecular formula C28H30N2O4 and a molecular weight of 458.5 g/mol. IUPAC name: 2-[3-diethylazaniumylidene-6-[diethyl(oxido)azaniumyl]xanthen-9-yl]benzoate. InChIKey: VBBOPWUGWHUQLA-UHFFFAOYSA-N.
| Molecular formula | C28H30N2O4 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | 2-[3-diethylazaniumylidene-6-[diethyl(oxido)azaniumyl]xanthen-9-yl]benzoate |
| InChIKey | VBBOPWUGWHUQLA-UHFFFAOYSA-N |
| SMILES | CC[N+](=C1C=CC2=C(C3=C(C=C(C=C3)[N+](CC)(CC)[O-])OC2=C1)C4=CC=CC=C4C(=O)[O-])CC |
Computed by PubChem (NCBI)
Synonyms:
RhoNox-1