CAS 1447838-87-0 is the registry number for 9,9-Diphenyl-N-(4-(9-phenyl-9H-carbazol-3-yl)phenyl)-9H-fluoren-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
9,9-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-2-amine (CAS 1447838-87-0) is a chemical compound with the molecular formula C49H34N2 and a molecular weight of 650.8 g/mol. IUPAC name: 9,9-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-2-amine. InChIKey: BMJXBQHLOQBQNQ-UHFFFAOYSA-N.
| Molecular formula | C49H34N2 |
|---|---|
| Molecular weight | 650.8 g/mol |
| IUPAC name | 9,9-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-2-amine |
| InChIKey | BMJXBQHLOQBQNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=C2C=C(C=C4)NC5=CC=C(C=C5)C6=CC7=C(C=C6)N(C8=CC=CC=C87)C9=CC=CC=C9)C1=CC=CC=C1 |
Computed by PubChem (NCBI)