CAS 1447943-05-6 is the registry number for Rel-(3aR,6aS)-5,5-difluorohexahydropentalen-2(1H)-one, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(3aR,6aS)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one (CAS 1447943-05-6) is a chemical compound with the molecular formula C8H10F2O and a molecular weight of 160.16 g/mol. IUPAC name: (3aR,6aS)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one. InChIKey: XLXHKWUHWJMLKF-OLQVQODUSA-N.
| Molecular formula | C8H10F2O |
|---|---|
| Molecular weight | 160.16 g/mol |
| IUPAC name | (3aR,6aS)-5,5-difluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| InChIKey | XLXHKWUHWJMLKF-OLQVQODUSA-N |
| SMILES | C1[C@@H]2CC(C[C@@H]2CC1=O)(F)F |
Computed by PubChem (NCBI)