Products 1447944-50-4
CAS 1447944-50-4 is the registry number for 2-(4,4-Difluorocyclohexyl)-2-methylpropanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-(4,4-difluorocyclohexyl)-2-methylpropanoic acid (CAS 1447944-50-4) is a chemical compound with the molecular formula C10H16F2O2 and a molecular weight of 206.23 g/mol. IUPAC name: 2-(4,4-difluorocyclohexyl)-2-methylpropanoic acid. InChIKey: KSZNWACBRHMZEF-UHFFFAOYSA-N.
| Molecular formula | C10H16F2O2 |
|---|---|
| Molecular weight | 206.23 g/mol |
| IUPAC name | 2-(4,4-difluorocyclohexyl)-2-methylpropanoic acid |
| InChIKey | KSZNWACBRHMZEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CCC(CC1)(F)F)C(=O)O |
Computed by PubChem (NCBI)