CAS 1448164-36-0 is the registry number for 4-nitropyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-nitropyridine;hydrochloride (CAS 1448164-36-0) is a chemical compound with the molecular formula C5H5ClN2O2 and a molecular weight of 160.56 g/mol. IUPAC name: 4-nitropyridine;hydrochloride. InChIKey: LSSVVJYZSHLSTN-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN2O2 |
|---|---|
| Molecular weight | 160.56 g/mol |
| IUPAC name | 4-nitropyridine;hydrochloride |
| InChIKey | LSSVVJYZSHLSTN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)