CAS 1448222-38-5 is the registry number for Poly(9,9-dihexylfluorenyl-2,7-diyl) end capped with dimethylphenyl. Offered by: Lumtec. Available pack sizes: On request.
9-(4-methylphenyl)-9-(9-phenylcarbazol-3-yl)fluorene-3-carbonitrile (CAS 1448222-38-5) is a chemical compound with the molecular formula C39H26N2 and a molecular weight of 522.6 g/mol. IUPAC name: 9-(4-methylphenyl)-9-(9-phenylcarbazol-3-yl)fluorene-3-carbonitrile. InChIKey: SGGKKAZRMDKLJR-UHFFFAOYSA-N.
| Molecular formula | C39H26N2 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | 9-(4-methylphenyl)-9-(9-phenylcarbazol-3-yl)fluorene-3-carbonitrile |
| InChIKey | SGGKKAZRMDKLJR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(C3=C(C=C(C=C3)C#N)C4=CC=CC=C42)C5=CC6=C(C=C5)N(C7=CC=CC=C76)C8=CC=CC=C8 |
Computed by PubChem (NCBI)