CAS 1448312-02-4 appears in our catalog under these names: Potassium (2,5-dibromophenyl)trifluoroborate, 95%, Potassium (2,5-dibromophenyl)trifluoroborate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
Potassium (2,5-dibromophenyl)-trifluoroboranuide (CAS 1448312-02-4) is a chemical compound with the molecular formula C6H3BBr2F3K and a molecular weight of 341.80 g/mol. IUPAC name: potassium (2,5-dibromophenyl)-trifluoroboranuide. InChIKey: QOCIRKLGBGHLKN-UHFFFAOYSA-N.
| Molecular formula | C6H3BBr2F3K |
|---|---|
| Molecular weight | 341.80 g/mol |
| IUPAC name | potassium (2,5-dibromophenyl)-trifluoroboranuide |
| InChIKey | QOCIRKLGBGHLKN-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC(=C1)Br)Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)