Products 1448314-67-7

CAS 1448314-67-7 is the registry number for 5-Sulfamoyl-1H-indazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-sulfamoyl-1H-indazole-3-carboxylic acid (CAS 1448314-67-7) is a chemical compound with the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. IUPAC name: 5-sulfamoyl-1H-indazole-3-carboxylic acid. InChIKey: VLXOVQLYZQNSMS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7N3O4S
Molecular weight241.23 g/mol
IUPAC name5-sulfamoyl-1H-indazole-3-carboxylic acid
InChIKeyVLXOVQLYZQNSMS-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1S(=O)(=O)N)C(=NN2)C(=O)O

Computed by PubChem (NCBI)