CAS 1448346-29-9 appears in our catalog under these names: Fenbendazole Impurity 1, Fenbendazole-amine hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile, Fenbendazole-amine hydrochloride. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x1ml, 1x10mg.
6-phenylsulfanyl-1H-benzimidazol-2-amine;hydrochloride (CAS 1448346-29-9) is a chemical compound with the molecular formula C13H12ClN3S and a molecular weight of 277.77 g/mol. IUPAC name: 6-phenylsulfanyl-1H-benzimidazol-2-amine;hydrochloride. InChIKey: VWHSPKSYMRODIP-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN3S |
|---|---|
| Molecular weight | 277.77 g/mol |
| IUPAC name | 6-phenylsulfanyl-1H-benzimidazol-2-amine;hydrochloride |
| InChIKey | VWHSPKSYMRODIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC3=C(C=C2)N=C(N3)N.Cl |
Computed by PubChem (NCBI)