Products 1448353-63-6
CAS 1448353-63-6 is the registry number for IMP2-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3,4-dichlorophenyl)-3-[[2-phenylethyl(propyl)carbamoyl]amino]thiophene-2-carboxylic acid (CAS 1448353-63-6) is a chemical compound with the molecular formula C23H22Cl2N2O3S and a molecular weight of 477.4 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-3-[[2-phenylethyl(propyl)carbamoyl]amino]thiophene-2-carboxylic acid. InChIKey: XPIUIWJKEDLORV-UHFFFAOYSA-N.
| Molecular formula | C23H22Cl2N2O3S |
|---|---|
| Molecular weight | 477.4 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-3-[[2-phenylethyl(propyl)carbamoyl]amino]thiophene-2-carboxylic acid |
| InChIKey | XPIUIWJKEDLORV-UHFFFAOYSA-N |
| SMILES | CCCN(CCC1=CC=CC=C1)C(=O)NC2=C(SC(=C2)C3=CC(=C(C=C3)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)