CAS 1448428-04-3 appears in our catalog under these names: Selonsertib, 97%, Selonsertib, Selonsertib/ 98.97% (existing batch purity), Selonsertib (GS–4997), Selonsertib 97%. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 1g, 250mg, 100mg, on request, 10mg, 1mg, 5mg, 25mg.
5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide (CAS 1448428-04-3) is a chemical compound with the molecular formula C24H24FN7O and a molecular weight of 445.5 g/mol. IUPAC name: 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide. InChIKey: YIDDLAAKOYYGJG-UHFFFAOYSA-N.
| Molecular formula | C24H24FN7O |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | 5-(4-cyclopropylimidazol-1-yl)-2-fluoro-4-methyl-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]benzamide |
| InChIKey | YIDDLAAKOYYGJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N2C=C(N=C2)C3CC3)C(=O)NC4=CC=CC(=N4)C5=NN=CN5C(C)C)F |
Computed by PubChem (NCBI)