CAS 1448435-38-8 is the registry number for AV-5080, 99.95%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 50 mg.
(3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2-fluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid (CAS 1448435-38-8) is a chemical compound with the molecular formula C15H25FN4O4 and a molecular weight of 344.38 g/mol. IUPAC name: (3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2-fluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid. InChIKey: GPJMJWZFIQXUME-DMDPSCGWSA-N.
| Molecular formula | C15H25FN4O4 |
|---|---|
| Molecular weight | 344.38 g/mol |
| IUPAC name | (3R,4R,5S)-5-(diaminomethylideneamino)-4-[(2-fluoroacetyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| InChIKey | GPJMJWZFIQXUME-DMDPSCGWSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)CF)N=C(N)N)C(=O)O |
Computed by PubChem (NCBI)