CAS 14485-80-4 appears in our catalog under these names: Z-Pro-leu-gly-nh2, 95%, Z-Pro-Leu-Gly-NH2, 95+%, Z–Pro–Leu–Gly–NH₂, Z-Pro-Leu-Gly-NH2. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
Benzyl N-[2-[[(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]carbamate (CAS 14485-80-4) is a chemical compound with the molecular formula C21H30N4O5 and a molecular weight of 418.5 g/mol. IUPAC name: benzyl N-[2-[[(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]carbamate. InChIKey: KFRZSJOPCRTHTH-IRXDYDNUSA-N.
| Molecular formula | C21H30N4O5 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | benzyl N-[2-[[(2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoyl]amino]acetyl]carbamate |
| InChIKey | KFRZSJOPCRTHTH-IRXDYDNUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)NC(=O)OCC1=CC=CC=C1)NC(=O)[C@@H]2CCCN2 |
Computed by PubChem (NCBI)