Products 1448523-50-9
CAS 1448523-50-9 is the registry number for FIKK9.1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-naphthalen-1-yl-5-phenyl-3-propan-2-yl-1,3-selenazolidin-2-imine (CAS 1448523-50-9) is a chemical compound with the molecular formula C22H22N2Se and a molecular weight of 393.4 g/mol. IUPAC name: N-naphthalen-1-yl-5-phenyl-3-propan-2-yl-1,3-selenazolidin-2-imine. InChIKey: LWPPICUNYNIVDW-UHFFFAOYSA-N.
| Molecular formula | C22H22N2Se |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | N-naphthalen-1-yl-5-phenyl-3-propan-2-yl-1,3-selenazolidin-2-imine |
| InChIKey | LWPPICUNYNIVDW-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC([Se]C1=NC2=CC=CC3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)