Products 144868-88-2
CAS 144868-88-2 is the registry number for 3,4-Difluoro-1,5-dioxaspiro(5.5)undecan-2-one. Offered by: TRC. Available pack sizes: 250mg.
2,3-difluoro-1,5-dioxaspiro[5.5]undecan-4-one (CAS 144868-88-2) is a chemical compound with the molecular formula C9H12F2O3 and a molecular weight of 206.19 g/mol. IUPAC name: 2,3-difluoro-1,5-dioxaspiro[5.5]undecan-4-one. InChIKey: LBRHWFYTFZNNTG-UHFFFAOYSA-N.
| Molecular formula | C9H12F2O3 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2,3-difluoro-1,5-dioxaspiro[5.5]undecan-4-one |
| InChIKey | LBRHWFYTFZNNTG-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)OC(C(C(=O)O2)F)F |
Computed by PubChem (NCBI)