CAS 1448850-54-1 is the registry number for (S)-tert-Butyl 3-((6-methylpyrimidin-4-yl)amino)pyrrolidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (3S)-3-[(6-methylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate (CAS 1448850-54-1) is a chemical compound with the molecular formula C14H22N4O2 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl (3S)-3-[(6-methylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate. InChIKey: ZGTDOCGOWZXXGI-NSHDSACASA-N.
| Molecular formula | C14H22N4O2 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl (3S)-3-[(6-methylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate |
| InChIKey | ZGTDOCGOWZXXGI-NSHDSACASA-N |
| SMILES | CC1=CC(=NC=N1)N[C@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)